ChemNet > CAS > 83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
| 상품명칭 |
2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
| 영문 이름 |
2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde;1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-; NSC 68230; 2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde; Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde; 2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
| 분자식 |
C13H19NO |
| 분자량 |
205.2961 |
| InChI |
InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
| cas번호 |
83-18-1 |
| EC번호 |
201-458-6 |
| 분자 구조 |
|
| 밀도 |
1.07g/cm3 |
| 비등점 |
345.8°C at 760 mmHg |
| 굴절 지수 |
1.559 |
| 인화점 |
163°C |
| 증기압 |
6E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
