83-27-2 Diethyl sec-Butylmalonate
상품명칭 |
Diethyl sec-Butylmalonate |
영문 이름 |
Diethyl sec-Butylmalonate; Butylmalonicaciddiethylester; sec-Butylmalonic acid diethyl ester; diethyl butan-2-ylpropanedioate; diethyl [(1S)-1-methylpropyl]propanedioate; diethyl [(1R)-1-methylpropyl]propanedioate |
분자식 |
C11H20O4 |
분자량 |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
cas번호 |
83-27-2 |
EC번호 |
201-463-3 |
분자 구조 |
|
밀도 |
0.992g/cm3 |
비등점 |
247.5°C at 760 mmHg |
굴절 지수 |
1.431 |
인화점 |
103.1°C |
증기압 |
0.0256mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|