830-03-5 4-Nitrophenyl acetate
상품명칭 |
4-Nitrophenyl acetate |
영문 이름 |
4-Nitrophenyl acetate; Acetic acid 4-nitrophenyl ester; p-Nitrophenol acetate |
분자식 |
C8H7NO4 |
분자량 |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
cas번호 |
830-03-5 |
EC번호 |
212-593-5 |
분자 구조 |
|
밀도 |
1.304g/cm3 |
녹는 점 |
76-79℃ |
비등점 |
296.8°C at 760 mmHg |
굴절 지수 |
1.548 |
인화점 |
145.2°C |
증기압 |
0.0014mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|