ChemNet > CAS > 840-65-3 dimethyl naphthalene-2,6-dicarboxylate
840-65-3 dimethyl naphthalene-2,6-dicarboxylate
상품명칭 |
dimethyl naphthalene-2,6-dicarboxylate |
영문 이름 |
dimethyl naphthalene-2,6-dicarboxylate; Naphthalene-2,6-dicarboxylic acid dimethyl ester; Dimethyl-2,6-naphthalene dicaboxylate; 2,6-DMN; Dimethyl 2,6-Naphthalenedicarboxylate |
분자식 |
C14H12O4 |
분자량 |
244.2427 |
InChI |
InChI=1/C14H12O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-8H,1-2H3 |
cas번호 |
840-65-3 |
EC번호 |
212-661-4 |
분자 구조 |
|
밀도 |
1.225g/cm3 |
녹는 점 |
187-190℃ |
비등점 |
375.3°C at 760 mmHg |
굴절 지수 |
1.594 |
인화점 |
189.2°C |
증기압 |
7.88E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|