ChemNet > CAS > 84282-78-0 3-chloro-4-fluorophenylhydrazine
84282-78-0 3-chloro-4-fluorophenylhydrazine
상품명칭 |
3-chloro-4-fluorophenylhydrazine |
영문 이름 |
3-chloro-4-fluorophenylhydrazine; |
분자식 |
C6H6ClFN2 |
분자량 |
160.5766 |
InChI |
InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
cas번호 |
84282-78-0 |
분자 구조 |
|
밀도 |
1.43g/cm3 |
녹는 점 |
62-63℃ |
비등점 |
253.1°C at 760 mmHg |
굴절 지수 |
1.624 |
인화점 |
106.9°C |
증기압 |
0.0187mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|