ChemNet > CAS > 84347-67-1 cis-N-(4-Chlorobutenyl)phthalimide
84347-67-1 cis-N-(4-Chlorobutenyl)phthalimide
상품명칭 |
cis-N-(4-Chlorobutenyl)phthalimide |
영문 이름 |
cis-N-(4-Chlorobutenyl)phthalimide;2-[(2Z)-4-chlorobut-2-en-1-yl]-1H-isoindole-1,3(2H)-dione |
분자식 |
C12H10ClNO2 |
분자량 |
235.6663 |
InChI |
InChI=1/C12H10ClNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-6H,7-8H2/b4-3- |
cas번호 |
84347-67-1 |
분자 구조 |
|
밀도 |
1.322g/cm3 |
녹는 점 |
79℃ |
비등점 |
374.2°C at 760 mmHg |
굴절 지수 |
1.602 |
인화점 |
180.1°C |
증기압 |
8.52E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|