84544-86-5 2-(페닐티오)에탄이미드아미드 염산염
| 상품명칭 |
2-(페닐티오)에탄이미드아미드 염산염 |
| 별명 |
; 2-(페닐티오)아세트아미딘 염산염; (1Z)-2-(페닐설파닐)에탄아미미드하이드로클로라이드; 1- 아미노 -2- (페닐 설파 닐) 에타니미니움 |
| 영문 이름 |
2-(phenylthio)ethanimidamide hydrochloride; 2-(Phenylthio)acetamidine hydrochloride; (1Z)-2-(phenylsulfanyl)ethanimidamide hydrochloride; 1-amino-2-(phenylsulfanyl)ethaniminium |
| 분자식 |
C8H11N2S |
| 분자량 |
167.2508 |
| InChI |
InChI=1/C8H10N2S/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H3,9,10)/p+1 |
| cas번호 |
84544-86-5 |
| 분자 구조 |
|
| 녹는 점 |
175℃ |
| 비등점 |
276.3°C at 760 mmHg |
| 인화점 |
120.9°C |
| 증기압 |
0.00485mmHg at 25°C |
| 위험성 표시 |
Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|