ChemNet > CAS > 84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
| 상품명칭 |
4-Dimethylamino-2-methoxybenzaldehyde |
| 영문 이름 |
4-Dimethylamino-2-methoxybenzaldehyde; |
| 분자식 |
C10H13NO2 |
| 분자량 |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c1-11(2)9-5-4-8(7-12)10(6-9)13-3/h4-7H,1-3H3 |
| cas번호 |
84562-48-1 |
| 분자 구조 |
|
| 밀도 |
1.098g/cm3 |
| 녹는 점 |
59-60℃ |
| 비등점 |
305.9°C at 760 mmHg |
| 굴절 지수 |
1.576 |
| 인화점 |
138.8°C |
| 증기압 |
0.000796mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
