ChemNet > CAS > 84604-70-6 1-(2,4-Dichlorophenyl)cyclopropanecarboxylic acid
84604-70-6 1-(2,4-Dichlorophenyl)cyclopropanecarboxylic acid
| 상품명칭 |
1-(2,4-Dichlorophenyl)cyclopropanecarboxylic acid |
| 영문 이름 |
1-(2,4-Dichlorophenyl)cyclopropanecarboxylic acid;1-(2,4-dichlorophenyl)cyclopropanecarboxylate |
| 분자식 |
C10H7Cl2O2 |
| 분자량 |
230.0679 |
| InChI |
InChI=1/C10H8Cl2O2/c11-6-1-2-7(8(12)5-6)10(3-4-10)9(13)14/h1-2,5H,3-4H2,(H,13,14)/p-1 |
| cas번호 |
84604-70-6 |
| EC번호 |
283-353-5 |
| 분자 구조 |
|
| 녹는 점 |
140-147℃ |
| 비등점 |
369.6°C at 760 mmHg |
| 인화점 |
177.3°C |
| 증기압 |
4.08E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
