ChemNet > CAS > 85-02-9 5,6-Benzoquinoline
85-02-9 5,6-Benzoquinoline
| 상품명칭 |
5,6-Benzoquinoline |
| 영문 이름 |
5,6-Benzoquinoline; beta-Naphthoquinoline; 1-Azaphenanthrene; Benzo[f]quinoline; Benzoquinoline; benzo(f)quinoline |
| 분자식 |
C13H9N |
| 분자량 |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
| cas번호 |
85-02-9 |
| EC번호 |
201-582-0 |
| 분자 구조 |
|
| 밀도 |
1.187g/cm3 |
| 녹는 점 |
89-91℃ |
| 비등점 |
350.4°C at 760 mmHg |
| 굴절 지수 |
1.726 |
| 인화점 |
155.9°C |
| 증기압 |
8.89E-05mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
