ChemNet > CAS > 85-55-2 2-(4-Methylbenzoyl)benzoic acid
85-55-2 2-(4-Methylbenzoyl)benzoic acid
| 상품명칭 |
2-(4-Methylbenzoyl)benzoic acid |
| 영문 이름 |
2-(4-Methylbenzoyl)benzoic acid; 2-(p-Toluoyl)benzoic acid; 4-Methylbenzophenone-2-carboxylic acid; 2-[(4-methylphenyl)carbonyl]benzoate |
| 분자식 |
C15H11O3 |
| 분자량 |
239.2466 |
| InChI |
InChI=1/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18)/p-1 |
| cas번호 |
85-55-2 |
| EC번호 |
201-614-3 |
| 분자 구조 |
|
| 녹는 점 |
137-139℃ |
| 비등점 |
457.1°C at 760 mmHg |
| 인화점 |
244.3°C |
| 증기압 |
3.79E-09mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
