ChemNet > CAS > 85199-06-0 2,5-Dimethylbenzeneboronic acid
85199-06-0 2,5-Dimethylbenzeneboronic acid
| 상품명칭 |
2,5-Dimethylbenzeneboronic acid |
| 영문 이름 |
2,5-Dimethylbenzeneboronic acid; 2,5-Dimethylphenylboronic acid; P-XYLENE-2-BORONIC ACID |
| 분자식 |
C8H11BO2 |
| 분자량 |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-6-3-4-7(2)8(5-6)9(10)11/h3-5,10-11H,1-2H3 |
| cas번호 |
85199-06-0 |
| 분자 구조 |
|
| 밀도 |
1.07g/cm3 |
| 녹는 점 |
186-191℃ |
| 비등점 |
305.1°C at 760 mmHg |
| 굴절 지수 |
1.523 |
| 인화점 |
138.3°C |
| 증기압 |
0.000367mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
