853-39-4 Decafluorobenzophenone

상품명칭	Decafluorobenzophenone
영문 이름	Decafluorobenzophenone;
분자식	C₁₃F₁₀O
분자량	362.12
InChI	InChI=1/C13F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17
cas번호	853-39-4
EC번호	212-717-8
분자 구조
녹는 점	92-94℃
위험성 표시	Xi:Irritant;
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.;