ChemNet > CAS > 855-97-0 3',4',5,7-Tetramethoxyflavone
855-97-0 3',4',5,7-Tetramethoxyflavone
상품명칭 |
3',4',5,7-Tetramethoxyflavone |
영문 이름 |
3',4',5,7-Tetramethoxyflavone; Luteolin tetramethyl ether; 2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one |
분자식 |
C19H18O6 |
분자량 |
342.3426 |
InChI |
InChI=1/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 |
cas번호 |
855-97-0 |
분자 구조 |
|
밀도 |
1.243g/cm3 |
비등점 |
528.8°C at 760 mmHg |
굴절 지수 |
1.574 |
인화점 |
233.9°C |
증기압 |
2.86E-11mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|