ChemNet > CAS > 86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
86129-63-7 ethyl 2,4-dichloro-6-methylnicotinate
| 상품명칭 |
ethyl 2,4-dichloro-6-methylnicotinate |
| 영문 이름 |
ethyl 2,4-dichloro-6-methylnicotinate; ethyl 2,4-dichloro-6-methylpyridine-3-carboxylate; 2,4-dichloro-6-methylpyridine-3-carboxylate |
| 분자식 |
C9H9Cl2NO2 |
| 분자량 |
234.0793 |
| InChI |
InChI=1/C9H9Cl2NO2/c1-3-14-9(13)7-6(10)4-5(2)12-8(7)11/h4H,3H2,1-2H3 |
| cas번호 |
86129-63-7 |
| 분자 구조 |
|
| 밀도 |
1.32g/cm3 |
| 녹는 점 |
56℃ |
| 비등점 |
298.2°C at 760 mmHg |
| 굴절 지수 |
1.537 |
| 인화점 |
134.1°C |
| 증기압 |
0.00129mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
