ChemNet > CAS > 868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
상품명칭 |
2-Amino-1-propene-1,1,3-tricarbonitrile |
영문 이름 |
2-Amino-1-propene-1,1,3-tricarbonitrile; 2-aminoprop-1-ene-1,1,3-tricarbonitrile |
분자식 |
C6H4N4 |
분자량 |
132.1228 |
InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
cas번호 |
868-54-2 |
EC번호 |
212-777-5 |
분자 구조 |
|
밀도 |
1.13g/cm3 |
녹는 점 |
171-173℃ |
비등점 |
454.9°C at 760 mmHg |
굴절 지수 |
1.565 |
인화점 |
228.9°C |
증기압 |
1.84E-08mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|