869-29-4 Allylidenediacetate
상품명칭 |
Allylidenediacetate |
영문 이름 |
Allylidenediacetate; 212-789-0; prop-1-ene-3,3-diyl diacetate |
분자식 |
C7H10O4 |
분자량 |
158.1519 |
InChI |
InChI=1/C7H10O4/c1-4-7(10-5(2)8)11-6(3)9/h4,7H,1H2,2-3H3 |
cas번호 |
869-29-4 |
EC번호 |
212-789-0 |
분자 구조 |
|
밀도 |
1.079g/cm3 |
비등점 |
180°C at 760 mmHg |
굴절 지수 |
1.428 |
인화점 |
78.3°C |
증기압 |
0.915mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|