87-29-6 cinnamyl anthranilate
상품명칭 |
cinnamyl anthranilate |
영문 이름 |
cinnamyl anthranilate; 2-Aminobenzoic acid cinnamyl ester~Cinnamyl anthranilate; 3-phenylprop-2-en-1-yl 2-aminobenzoate; (2E)-3-phenylprop-2-en-1-yl 2-aminobenzoate |
분자식 |
C16H15NO2 |
분자량 |
253.2958 |
InChI |
InChI=1/C16H15NO2/c17-15-11-5-4-10-14(15)16(18)19-12-6-9-13-7-2-1-3-8-13/h1-11H,12,17H2/b9-6+ |
cas번호 |
87-29-6 |
EC번호 |
201-738-8 |
분자 구조 |
|
밀도 |
1.178g/cm3 |
비등점 |
449.1°C at 760 mmHg |
굴절 지수 |
1.642 |
인화점 |
269.4°C |
증기압 |
2.95E-08mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|