87-52-5 Gramine
상품명칭 |
Gramine |
영문 이름 |
Gramine; 3-(Dimethylaminomethyl)indole; (1H-Indol-3-ylmethyl)-dimethyl-amine |
분자식 |
C11H14N2 |
분자량 |
174.2423 |
InChI |
InChI=1/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
cas번호 |
87-52-5 |
EC번호 |
201-749-8 |
분자 구조 |
|
밀도 |
1.099g/cm3 |
녹는 점 |
131-139℃ |
비등점 |
293.9°C at 760 mmHg |
굴절 지수 |
1.63 |
인화점 |
131.5°C |
물 용해도 |
PRACTICALLY INSOLUBLE |
증기압 |
0.00168mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36:Irritating to eyes.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S46:If swallowed, seek medical advice immediately and show this container or label.;
|
|