ChemNet > CAS > 874-87-3 p-(Methylthio)benzyl chloride
874-87-3 p-(Methylthio)benzyl chloride
| 상품명칭 |
p-(Methylthio)benzyl chloride |
| 영문 이름 |
p-(Methylthio)benzyl chloride; 4-(Methylthio)benzyl chloride; 4-(Chloromethyl)thioanisole; 1-(chloromethyl)-4-(methylsulfanyl)benzene |
| 분자식 |
C8H9ClS |
| 분자량 |
172.6751 |
| InChI |
InChI=1/C8H9ClS/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
| cas번호 |
874-87-3 |
| EC번호 |
212-870-0 |
| 분자 구조 |
|
| 밀도 |
1.16g/cm3 |
| 비등점 |
262.3°C at 760 mmHg |
| 굴절 지수 |
1.574 |
| 인화점 |
110.5°C |
| 증기압 |
0.0179mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
