ChemNet > CAS > 875-59-2 4'-Hydroxy-2'-methylacetophenone
875-59-2 4'-Hydroxy-2'-methylacetophenone
| 상품명칭 |
4'-Hydroxy-2'-methylacetophenone |
| 영문 이름 |
4'-Hydroxy-2'-methylacetophenone; 2'-Methyl-4'-hydroxyacetophenone |
| 분자식 |
C9H10O2 |
| 분자량 |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-6-5-8(11)3-4-9(6)7(2)10/h3-5,11H,1-2H3 |
| cas번호 |
875-59-2 |
| EC번호 |
212-874-2 |
| 분자 구조 |
|
| 밀도 |
1.106g/cm3 |
| 녹는 점 |
127-132℃ |
| 비등점 |
313°C at 760 mmHg |
| 굴절 지수 |
1.546 |
| 인화점 |
127.9°C |
| 증기압 |
0.000278mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
