877-43-0 2,6-Dimethylquinoline
상품명칭 |
2,6-Dimethylquinoline |
영문 이름 |
2,6-Dimethylquinoline; 6-METHYLQUINALDINE; 2,6-dimethyl-quinolin; P-TOLUQUINALDINE; Quinoline, 2,6-dimethyl- |
분자식 |
C11H11N |
분자량 |
157.2117 |
InChI |
InChI=1/C11H11N/c1-8-3-6-11-10(7-8)5-4-9(2)12-11/h3-7H,1-2H3 |
cas번호 |
877-43-0 |
EC번호 |
212-891-5 |
분자 구조 |
|
밀도 |
1.052g/cm3 |
녹는 점 |
56-60 °C |
비등점 |
266.5°C at 760 mmHg |
굴절 지수 |
1.61 |
인화점 |
106.5°C |
증기압 |
0.0142mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|