ChemNet > CAS > 881-07-2 8-Nitroquinaldine
881-07-2 8-Nitroquinaldine
| 상품명칭 |
8-Nitroquinaldine |
| 영문 이름 |
8-Nitroquinaldine; Nitroquinaldine; 2-Methyl-8-nitroquinoline |
| 분자식 |
C10H8N2O2 |
| 분자량 |
188.1827 |
| InChI |
InChI=1/C10H8N2O2/c1-7-5-6-8-3-2-4-9(12(13)14)10(8)11-7/h2-6H,1H3 |
| cas번호 |
881-07-2 |
| EC번호 |
212-919-6 |
| 분자 구조 |
|
| 밀도 |
1.298g/cm3 |
| 비등점 |
323.8°C at 760 mmHg |
| 굴절 지수 |
1.661 |
| 인화점 |
149.6°C |
| 증기압 |
0.000483mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
