ChemNet > CAS > 881-86-7 Dimethyl 2,5-pyridinedicarboxylate
881-86-7 Dimethyl 2,5-pyridinedicarboxylate
| 상품명칭 |
Dimethyl 2,5-pyridinedicarboxylate |
| 영문 이름 |
Dimethyl 2,5-pyridinedicarboxylate; Dimethyl pyridine-2,5-dicarboxylate; Dimethyl isocinchomeronate; Pyridine-2,5-dicarboxylic acid dimethyl ester; Dimethyl-2,5-pyridinecarboxylate |
| 분자식 |
C9H9NO4 |
| 분자량 |
195.1721 |
| InChI |
InChI=1/C9H9NO4/c1-13-8(11)6-3-4-7(10-5-6)9(12)14-2/h3-5H,1-2H3 |
| cas번호 |
881-86-7 |
| 분자 구조 |
|
| 밀도 |
1.231g/cm3 |
| 녹는 점 |
213-217℃ |
| 비등점 |
302.9°C at 760 mmHg |
| 굴절 지수 |
1.516 |
| 인화점 |
137°C |
| 증기압 |
0.000961mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
