886-38-4 Diphenylcyclopropenone
상품명칭 |
Diphenylcyclopropenone |
영문 이름 |
Diphenylcyclopropenone; Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one; 1,2-Diphenylcycelopropen-3-One; 1,2-Diphenylcyclopropen-3-one |
분자식 |
C15H10O |
분자량 |
206.2393 |
InChI |
InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
cas번호 |
886-38-4 |
EC번호 |
212-948-4 |
분자 구조 |
|
밀도 |
1.232g/cm3 |
녹는 점 |
119-121℃ |
비등점 |
407.2°C at 760 mmHg |
굴절 지수 |
1.668 |
인화점 |
182.7°C |
증기압 |
7.66E-07mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R43:May cause sensitization by skin contact.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|