ChemNet > CAS > 886-65-7 trans,trans-1,4-Diphenyl-1,3-butadiene
886-65-7 trans,trans-1,4-Diphenyl-1,3-butadiene
| 상품명칭 |
trans,trans-1,4-Diphenyl-1,3-butadiene |
| 영문 이름 |
trans,trans-1,4-Diphenyl-1,3-butadiene; DPB; 1,4-Diphenyl-1,3-butadiene; bistyryl; 1,1'-(1Z,3Z)-buta-1,3-diene-1,4-diyldibenzene |
| 분자식 |
C16H14 |
| 분자량 |
206.2824 |
| InChI |
InChI=1/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7-,14-8- |
| cas번호 |
886-65-7 |
| EC번호 |
212-952-6 |
| 분자 구조 |
|
| 밀도 |
1.035g/cm3 |
| 녹는 점 |
151-154℃ |
| 비등점 |
367°C at 760 mmHg |
| 굴절 지수 |
1.653 |
| 인화점 |
190°C |
| 증기압 |
2.97E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
