ChemNet > CAS > 90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
상품명칭 |
2-Hydroxy-4,6-dimethoxyacetophenone |
영문 이름 |
2-Hydroxy-4,6-dimethoxyacetophenone; xanthoxylin |
분자식 |
C10H12O4 |
분자량 |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
cas번호 |
90-24-4 |
EC번호 |
201-978-3 |
분자 구조 |
|
밀도 |
1.172g/cm3 |
녹는 점 |
80-82℃ |
비등점 |
355.1°C at 760 mmHg |
굴절 지수 |
1.527 |
인화점 |
141.2°C |
증기압 |
1.57E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|