ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
상품명칭 |
poly(chlorotrifluoroethylene) |
영문 이름 |
poly(chlorotrifluoroethylene); halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
분자식 |
C2ClF3 |
분자량 |
116.4693 |
InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
cas번호 |
9002-83-9 |
분자 구조 |
|
밀도 |
1.9 |
녹는 점 |
210℃ |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|