ChemNet > CAS > 9005-84-9 Soluble Starch
9005-84-9 Soluble Starch
| 상품명칭 |
Soluble Starch |
| 영문 이름 |
Soluble Starch; Starch; starch from maize; starch potato soluble; starch hydrolyzed for electrophoresis*from potato; starch potato hydrolyzed for*electrophoresis; Starch, Soluble, Corn (1.01257); Starch, Soluble GR, Corn (1.01252); Starch, soluble; Starch from potatoes; Starch soluble; Pregelatinized Starch |
| 분자식 |
C12H22O11 |
| 분자량 |
342.2948 |
| InChI |
InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
| cas번호 |
9005-84-9 |
| EC번호 |
232-686-4 |
| 분자 구조 |
|
| 밀도 |
1.5 |
| 녹는 점 |
256-258℃ |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
