9009-54-5 Polyurethane
상품명칭 |
Polyurethane |
영문 이름 |
Polyurethane; Polyurethane foam; Polyurethane foams; Polyisocyanurate resins; Polyurethanes, cellular; PU foam; The following companies react isocyanates or prepolymers with polyols to produce polyurethane foams. The list is incomplete.; POLYURETHANEOLIGOMERS; POLYURETHANEVARNISH; PU; Acrylic polyurethane paint; Acrylic polyurethane anticorrosive coating; Polyurethane mixed component; 1-ethylurea |
분자식 |
C3H8N2O |
분자량 |
88.1084 |
InChI |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
cas번호 |
9009-54-5 |
EC번호 |
210-898-8 |
분자 구조 |
|
밀도 |
1.005g/cm3 |
비등점 |
136.3°C at 760 mmHg |
굴절 지수 |
1.44 |
인화점 |
36.2°C |
증기압 |
7.44mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|