ChemNet > CAS > 9011-14-7 Poly(methyl methacrylate)
9011-14-7;9065-11-6 Poly(methyl methacrylate)
상품명칭 |
Poly(methyl methacrylate) |
영문 이름 |
Poly(methyl methacrylate); Methyl Methacrylate Resin (High M.Wt.); Methacrylic Acid Methyl Ester, Polymer n=13,500-14,000; PMMA; 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer; Acryloid; Methyl methacrylate homopolymer; Methyl methacrylate, polymerized; Methyl methacrylate resin; Poly(methyl methacrylate), beads |
분자식 |
(C5H8O2)x |
분자량 |
99.1083 |
InChI |
InChI=1/C5H7O2/c1-4(2)5(6)7-3/h1H,2-3H3 |
cas번호 |
9011-14-7;9065-11-6 |
분자 구조 |
|
밀도 |
1.18 |
녹는 점 |
105℃ |
굴절 지수 |
1.49 |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|