ChemNet > CAS > 90259-31-7 2-Bromo-6-methylbenzoic acid
90259-31-7 2-Bromo-6-methylbenzoic acid
상품명칭 |
2-Bromo-6-methylbenzoic acid |
영문 이름 |
2-Bromo-6-methylbenzoic acid; 6-Bromo-o-toluic acid |
분자식 |
C8H7BrO2 |
분자량 |
215.044 |
InChI |
InChI=1/C8H7BrO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
cas번호 |
90259-31-7 |
분자 구조 |
|
밀도 |
1.6g/cm3 |
녹는 점 |
108-112℃ |
비등점 |
307.043°C at 760 mmHg |
굴절 지수 |
1.595 |
인화점 |
139.495°C |
증기압 |
0mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|