ChemNet > CAS > 90721-27-0 1-benzofuran-5-carboxylic acid
90721-27-0 1-benzofuran-5-carboxylic acid
상품명칭 |
1-benzofuran-5-carboxylic acid |
영문 이름 |
1-benzofuran-5-carboxylic acid; |
분자식 |
C9H6O3 |
분자량 |
162.1421 |
InChI |
InChI=1/C9H6O3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11) |
cas번호 |
90721-27-0 |
분자 구조 |
|
밀도 |
1.363g/cm3 |
녹는 점 |
188℃ |
비등점 |
325.6°C at 760 mmHg |
굴절 지수 |
1.649 |
인화점 |
150.7°C |
증기압 |
9.31E-05mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|