ChemNet > CAS > 493-01-6;91-17-8 cis-Decahydronaphthalene
493-01-6;91-17-8 cis-Decahydronaphthalene
| 상품명칭 |
cis-Decahydronaphthalene |
| 영문 이름 |
cis-Decahydronaphthalene; cis-bicyclo(4.4.0)decane; cis-decaline; Decahydronaphthalene; Deca hydro naphthalene; Decalin |
| 분자식 |
C10H18 |
| 분자량 |
138.2499 |
| InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
| cas번호 |
493-01-6;91-17-8 |
| EC번호 |
202-046-9 |
| 분자 구조 |
|
| 밀도 |
0.873g/cm3 |
| 녹는 점 |
-31℃ |
| 비등점 |
190.879°C at 760 mmHg |
| 굴절 지수 |
1.47 |
| 인화점 |
57.222°C |
| 물 용해도 |
6 mg/L at 20℃ |
| 증기압 |
0.735mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
