92-24-0 2,3-Benzanthracene
상품명칭 |
2,3-Benzanthracene |
영문 이름 |
2,3-Benzanthracene; NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
분자식 |
C18H12 |
분자량 |
228.2879 |
InChI |
InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
cas번호 |
92-24-0 |
EC번호 |
202-138-9 |
분자 구조 |
|
밀도 |
1.19g/cm3 |
녹는 점 |
300℃ |
비등점 |
436.7°C at 760 mmHg |
굴절 지수 |
1.771 |
인화점 |
209.1°C |
증기압 |
2.02E-07mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|