92-32-0 Pyronin Y
상품명칭 |
Pyronin Y |
영문 이름 |
Pyronin Y; C.I. 45005; Pyronine; Pyronin G; PYRONINE G; pyronin Y molecular biology; Pyronin Y, CI 45005; Pyronine Y; N-[6-(dimethylamino)-3H-xanthen-3-ylidene]-N-methylmethanaminium chloride |
분자식 |
C17H19ClN2O |
분자량 |
302.7986 |
InChI |
InChI=1/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1 |
cas번호 |
92-32-0 |
EC번호 |
202-147-8 |
분자 구조 |
|
녹는 점 |
250-260℃ |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|