923-06-8 DL-Bromosuccinic acid
상품명칭 |
DL-Bromosuccinic acid |
영문 이름 |
DL-Bromosuccinic acid; Bromobutanedioic acid; Bromosuccinic Acid; 2-bromobutanedioic acid; (2R)-2-bromobutanedioate; (2S)-2-bromobutanedioate; 2-Bromosuccinic acid |
분자식 |
C4H3BrO4 |
분자량 |
194.9693 |
InChI |
InChI=1/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1 |
cas번호 |
923-06-8 |
EC번호 |
213-087-7 |
분자 구조 |
|
녹는 점 |
160-162℃ |
비등점 |
255.1°C at 760 mmHg |
인화점 |
108.1°C |
증기압 |
0.00512mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|