ChemNet > CAS > 931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
상품명칭 |
1,2-Cyclohexanediol, mixture of cis and trans |
영문 이름 |
1,2-Cyclohexanediol, mixture of cis and trans; 1,2-Cyclohexanediol, cis/trans-mix; 1,2-Cyclohexanediol; 1,2-Cyclohexandiol |
분자식 |
C6H12O2 |
분자량 |
116.16 |
InChI |
InChI=1/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 |
cas번호 |
931-17-9 |
EC번호 |
213-229-8 |
분자 구조 |
|
녹는 점 |
73-77℃ |
비등점 |
118-120℃ (10 mmHg) |
물 용해도 |
soluble |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S23:;
S24/25:;
|
|