ChemNet > CAS > 932-66-1 1-Acetyl-1-cyclohexene
932-66-1 1-Acetyl-1-cyclohexene
| 상품명칭 |
1-Acetyl-1-cyclohexene |
| 영문 이름 |
1-Acetyl-1-cyclohexene; cyclohex-1-enyl methyl ketone; 1-(cyclohex-1-en-1-yl)ethanone |
| 분자식 |
C8H12O |
| 분자량 |
124.1803 |
| InChI |
InChI=1/C8H12O/c1-7(9)8-5-3-2-4-6-8/h5H,2-4,6H2,1H3 |
| cas번호 |
932-66-1 |
| EC번호 |
213-256-5 |
| 분자 구조 |
|
| 밀도 |
0.962g/cm3 |
| 녹는 점 |
73-202℃ |
| 비등점 |
201.7°C at 760 mmHg |
| 굴절 지수 |
1.477 |
| 인화점 |
73.2°C |
| 증기압 |
0.304mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
