933-78-8 2,3,5-Trichlorophenol

상품명칭	2,3,5-Trichlorophenol
영문 이름	2,3,5-Trichlorophenol;
분자식	C₆H₃Cl₃O
분자량	197.4464
InChI	InChI=1/C6H3Cl3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H
cas번호	933-78-8
EC번호	213-272-2
분자 구조
밀도	1.596g/cm³
녹는 점	57-60℃
비등점	250.2°C at 760 mmHg
굴절 지수	1.608
인화점	105.1°C
증기압	0.0139mmHg at 25°C
위험성 표시	Xn:Harmful;
리스크 규칙	R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.;