ChemNet > CAS > 93413-76-4 Intermediate of Venlafaxine
93413-76-4 Intermediate of Venlafaxine
상품명칭 |
Intermediate of Venlafaxine |
영문 이름 |
Intermediate of Venlafaxine; 1-(cyclohexanol)-(4methoxyphenyl)acetonitrile; 1-[Cyano(4-methoxyphenyl)methyl]cyclohexanol; 1-[Cyano-(p-methoxyphenyl)methyl]cyclohexanol; (1-hydroxycyclohexyl)(4-methoxyphenyl)acetonitrile; 1-[(1-Cyano)-1-(4-methoxyphenyl)methyl cyclohexanol; 1-[2-amlno-1-(4-methoxyphenyl)ethyl]cyciohexanol; 1-Cyano-(4-methoxyphenyl)methyl cyclohexanol |
분자식 |
C15H19NO2 |
분자량 |
245.3169 |
InChI |
InChI=1/C15H19NO2/c1-18-13-7-5-12(6-8-13)14(11-16)15(17)9-3-2-4-10-15/h5-8,14,17H,2-4,9-10H2,1H3 |
cas번호 |
93413-76-4 |
분자 구조 |
|
밀도 |
1.142g/cm3 |
녹는 점 |
121-123°C |
비등점 |
410.146°C at 760 mmHg |
굴절 지수 |
1.561 |
인화점 |
201.849°C |
증기압 |
0mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|