935-69-3 7-Methyladenine
상품명칭 |
7-Methyladenine |
영문 이름 |
7-Methyladenine; 6-Amino-7-methylpurine; 7-methyl-7H-purin-6-amine |
분자식 |
C6H7N5 |
분자량 |
149.1533 |
InChI |
InChI=1/C6H7N5/c1-11-3-10-6-4(11)5(7)8-2-9-6/h2-3H,1H3,(H2,7,8,9) |
cas번호 |
935-69-3 |
분자 구조 |
|
밀도 |
1.6g/cm3 |
녹는 점 |
323℃ |
비등점 |
385.9°C at 760 mmHg |
굴절 지수 |
1.807 |
인화점 |
187.2°C |
증기압 |
3.67E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|