ChemNet > CAS > 937-63-3 p-Tolyl chlorothionoformate
937-63-3 p-Tolyl chlorothionoformate
상품명칭 |
p-Tolyl chlorothionoformate |
영문 이름 |
p-Tolyl chlorothionoformate; p-Tolyl chlorothioformate; O-(4-methylphenyl) carbonochloridothioate |
분자식 |
C8H7ClOS |
분자량 |
186.6586 |
InChI |
InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
cas번호 |
937-63-3 |
EC번호 |
213-333-3 |
분자 구조 |
|
밀도 |
1.277g/cm3 |
비등점 |
244.8°C at 760 mmHg |
굴절 지수 |
1.598 |
인화점 |
101.8°C |
증기압 |
0.0466mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|