ChemNet > CAS > 937-64-4 4-chlorophenyl chlorothionoformate
937-64-4 4-chlorophenyl chlorothionoformate
상품명칭 |
4-chlorophenyl chlorothionoformate |
영문 이름 |
4-chlorophenyl chlorothionoformate; O-(4-Chlorophenyl chlorothioformate); O-(4-chlorophenyl) carbonochloridothioate; 4-chlorophenyl chlorothioformate |
분자식 |
C7H4Cl2OS |
분자량 |
207.0771 |
InChI |
InChI=1/C7H4Cl2OS/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H |
cas번호 |
937-64-4 |
EC번호 |
213-334-9 |
분자 구조 |
|
밀도 |
1.46g/cm3 |
비등점 |
251.7°C at 760 mmHg |
굴절 지수 |
1.622 |
인화점 |
106°C |
증기압 |
0.0321mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|