ChemNet > CAS > 93957-49-4 1-Isopropyl-3-(4-fluorophenyl)indole
93957-49-4 1-Isopropyl-3-(4-fluorophenyl)indole
상품명칭 |
1-Isopropyl-3-(4-fluorophenyl)indole |
영문 이름 |
1-Isopropyl-3-(4-fluorophenyl)indole; 3-(4-Fluorophenyl)-1-Isopropyl-1H-Indole; N-isopropyl-3-(4-fluorophenyl)-1H-indole; 3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole; Fluvastatin sodium intermediate F1; 3-(4-Fluorobenzene)-1-(1-methylethyl)-1-H-indole; 3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indole; 3-(4-3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indol |
분자식 |
C17H16FN |
분자량 |
253.314 |
InChI |
InChI=1/C17H16FN/c1-12(2)19-11-16(13-7-9-14(18)10-8-13)15-5-3-4-6-17(15)19/h3-12H,1-2H3 |
cas번호 |
93957-49-4 |
EC번호 |
418-790-4 |
분자 구조 |
|
밀도 |
1.08g/cm3 |
비등점 |
389.6°C at 760 mmHg |
굴절 지수 |
1.573 |
인화점 |
189.4°C |
증기압 |
6.32E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|