94-81-5 MCPB

상품명칭	MCPB
영문 이름	MCPB; 4-(4-Chloro-o-tolyloxy)butyric acid; 2,4-MCPB; 4-(4-Chloro-2-methylphenoxy)butyric acid; MCPB; 4-(2-Methyl-4-chlorophenoxy)butyric acid; 2-(4-chloro-2-methylphenoxy)butanoic acid
분자식	C₁₁H₁₃ClO₃
분자량	228.6721
InChI	InChI=1/C11H13ClO3/c1-3-9(11(13)14)15-10-5-4-8(12)6-7(10)2/h4-6,9H,3H2,1-2H3,(H,13,14)
cas번호	94-81-5
EC번호	202-365-3
분자 구조
밀도	1.228g/cm³
비등점	345.1°C at 760 mmHg
굴절 지수	1.536
인화점	162.5°C
증기압	2.39E-05mmHg at 25°C
위험성 표시
리스크 규칙	R22:Harmful if swallowed.;
보안 규칙	S24/25:Avoid contact with skin and eyes.;