ChemNet > CAS > 94-86-0 trans-2-ethoxy-5-(1-propenyl)phenol
94-86-0 trans-2-ethoxy-5-(1-propenyl)phenol
상품명칭 |
trans-2-ethoxy-5-(1-propenyl)phenol |
영문 이름 |
trans-2-ethoxy-5-(1-propenyl)phenol; 2-Ethoxy-5-prop-1-enylphenol; 5-propenylguaethol; Vanitrope; 2-ethoxy-5-(prop-1-en-1-yl)phenol; 2-ethoxy-5-[(1E)-prop-1-en-1-yl]phenol; Propenyl guaethol |
분자식 |
C11H14O2 |
분자량 |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-3-5-9-6-7-11(13-4-2)10(12)8-9/h3,5-8,12H,4H2,1-2H3/b5-3+ |
cas번호 |
94-86-0 |
EC번호 |
202-370-0 |
분자 구조 |
|
밀도 |
1.052g/cm3 |
녹는 점 |
86-88℃ |
비등점 |
312.8°C at 760 mmHg |
굴절 지수 |
1.567 |
인화점 |
165.2°C |
증기압 |
0.000281mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|