ChemNet > CAS > 940-90-9 benzoic acid, compound with diethylamine (1:1)
940-90-9 benzoic acid, compound with diethylamine (1:1)
상품명칭 |
benzoic acid, compound with diethylamine (1:1) |
영문 이름 |
benzoic acid, compound with diethylamine (1:1);Benzoic acid, compound with diethylamine (1:1); N-ethylethanaminium benzoate |
분자식 |
C11H17NO2 |
분자량 |
195.2582 |
InChI |
InChI=1/C7H6O2.C4H11N/c8-7(9)6-4-2-1-3-5-6;1-3-5-4-2/h1-5H,(H,8,9);5H,3-4H2,1-2H3 |
cas번호 |
940-90-9 |
EC번호 |
213-377-3 |
분자 구조 |
|
비등점 |
317.9°C at 760 mmHg |
인화점 |
146.1°C |
증기압 |
0.000156mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|