942-92-7 Hexanophenone
상품명칭 |
Hexanophenone |
영문 이름 |
Hexanophenone; n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
분자식 |
C12H16O |
분자량 |
176.2548 |
InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
cas번호 |
942-92-7 |
EC번호 |
213-394-6 |
분자 구조 |
|
밀도 |
0.942g/cm3 |
녹는 점 |
25-26℃ |
비등점 |
265°C at 760 mmHg |
굴절 지수 |
1.498 |
인화점 |
105.5°C |
증기압 |
0.0094mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|