943-93-1 1,2-Epoxy-5,9-cyclododecadiene

상품명칭	1,2-Epoxy-5,9-cyclododecadiene
영문 이름	1,2-Epoxy-5,9-cyclododecadiene;
분자식	C₁₂H₁₈O
분자량	178.2707
InChI	InChI=1/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3-6,11-12H,1-2,7-10H2/b5-3+,6-4+
cas번호	943-93-1
EC번호	213-407-5
분자 구조
밀도	0.941g/cm³
비등점	269.8°C at 760 mmHg
굴절 지수	1.484
인화점	113.6°C
증기압	0.0118mmHg at 25°C
위험성 표시
리스크 규칙	R36/38:Irritating to eyes and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;